C12H27N3O3 — CID 103409983
3-[ethyl-[3-(2-methoxyethoxy)propyl]amino]-N'-hydroxy-2-methylpropanimidamide (PubChem CID 103409983) has the molecular formula C12H27N3O3 and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-[ethyl-[3-(2-methoxyethoxy)propyl]amino]-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-[ethyl-[3-(2-methoxyethoxy)propyl]amino]-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 103409983 |
| Molecular Formula | C12H27N3O3 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 3-[ethyl-[3-(2-methoxyethoxy)propyl]amino]-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CCN(CCCOCCOC)CC(C)C(N)=NO |
| InChI | InChI=1S/C12H27N3O3/c1-4-15(10-11(2)12(13)14-16)6-5-7-18-9-8-17-3/h11,16H,4-10H2,1-3H3,(H2,13,14) |
| InChIKey | QGNPBZJFADMEQF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|