C10H23N3O3 — CID 103409990
N'-hydroxy-2-[3-(2-methoxyethoxy)propyl-methylamino]propanimidamide (PubChem CID 103409990) has the molecular formula C10H23N3O3 and a molecular weight of 233.31 g/mol. Its IUPAC name is N'-hydroxy-2-[3-(2-methoxyethoxy)propyl-methylamino]propanimidamide.
| Compound Name | N'-hydroxy-2-[3-(2-methoxyethoxy)propyl-methylamino]propanimidamide |
|---|---|
| PubChem CID | 103409990 |
| Molecular Formula | C10H23N3O3 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.17 |
| IUPAC Name | N'-hydroxy-2-[3-(2-methoxyethoxy)propyl-methylamino]propanimidamide |
| SMILES | COCCOCCCN(C)C(C)C(N)=NO |
| InChI | InChI=1S/C10H23N3O3/c1-9(10(11)12-14)13(2)5-4-6-16-8-7-15-3/h9,14H,4-8H2,1-3H3,(H2,11,12) |
| InChIKey | ASXYSZONDHCWER-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|