C9H21N3O3 — CID 76914953
2-[bis(2-methoxyethyl)amino]-N'-hydroxypropanimidamide (PubChem CID 76914953) has the molecular formula C9H21N3O3 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-[bis(2-methoxyethyl)amino]-N'-hydroxypropanimidamide.
| Compound Name | 2-[bis(2-methoxyethyl)amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 76914953 |
| Molecular Formula | C9H21N3O3 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 2-[bis(2-methoxyethyl)amino]-N'-hydroxypropanimidamide |
| SMILES | COCCN(CCOC)C(C)C(N)=NO |
| InChI | InChI=1S/C9H21N3O3/c1-8(9(10)11-13)12(4-6-14-2)5-7-15-3/h8,13H,4-7H2,1-3H3,(H2,10,11) |
| InChIKey | JFWKRVNKJNPIKB-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|