C11H25N3O3 — CID 103410003
N'-hydroxy-2-[3-(2-methoxyethoxy)propyl-propan-2-ylamino]ethanimidamide (PubChem CID 103410003) has the molecular formula C11H25N3O3 and a molecular weight of 247.34 g/mol. Its IUPAC name is N'-hydroxy-2-[3-(2-methoxyethoxy)propyl-propan-2-ylamino]ethanimidamide.
| Compound Name | N'-hydroxy-2-[3-(2-methoxyethoxy)propyl-propan-2-ylamino]ethanimidamide |
|---|---|
| PubChem CID | 103410003 |
| Molecular Formula | C11H25N3O3 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | N'-hydroxy-2-[3-(2-methoxyethoxy)propyl-propan-2-ylamino]ethanimidamide |
| SMILES | COCCOCCCN(CC(N)=NO)C(C)C |
| InChI | InChI=1S/C11H25N3O3/c1-10(2)14(9-11(12)13-15)5-4-6-17-8-7-16-3/h10,15H,4-9H2,1-3H3,(H2,12,13) |
| InChIKey | MSZMZVQHCDJDKH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|