C24H34O5 — CID 10341068
[3-acetyloxy-2-[(1R,4S,6S,9E,12S)-4,9,12-trimethyl-5-oxatricyclo[10.3.0.04,6]pentadeca-9,13-dien-15-ylidene]propyl] acetate (PubChem CID 10341068) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is [3-acetyloxy-2-[(1R,4S,6S,9E,12S)-4,9,12-trimethyl-5-oxatricyclo[10.3.0.04,6]pentadeca-9,13-dien-15-ylidene]propyl] acetate.
| Compound Name | [3-acetyloxy-2-[(1R,4S,6S,9E,12S)-4,9,12-trimethyl-5-oxatricyclo[10.3.0.04,6]pentadeca-9,13-dien-15-ylidene]propyl] acetate |
|---|---|
| PubChem CID | 10341068 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [3-acetyloxy-2-[(1R,4S,6S,9E,12S)-4,9,12-trimethyl-5-oxatricyclo[10.3.0.04,6]pentadeca-9,13-dien-15-ylidene]propyl] acetate |
| SMILES | CC(=O)OCC(COC(C)=O)=C1C=C[C@]2(C)C/C=C(\C)CC[C@@H]3O[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C24H34O5/c1-16-6-7-22-24(5,29-22)13-10-21-20(9-12-23(21,4)11-8-16)19(14-27-17(2)25)15-28-18(3)26/h8-9,12,21-22H,6-7,10-11,13-15H2,1-5H3/b16-8+/t21-,22-,23-,24-/m0/s1 |
| InChIKey | GIWRFROSNZDMIG-XHKVDLCLSA-N |
| XLogP | 4.67 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|