C15H21ClO4 — CID 103410965
2-[(2-chlorophenyl)methyl]-5-(2-methoxyethoxy)pentanoic acid (PubChem CID 103410965) has the molecular formula C15H21ClO4 and a molecular weight of 300.78 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-5-(2-methoxyethoxy)pentanoic acid.
| Compound Name | 2-[(2-chlorophenyl)methyl]-5-(2-methoxyethoxy)pentanoic acid |
|---|---|
| PubChem CID | 103410965 |
| Molecular Formula | C15H21ClO4 |
| Molecular Weight | 300.78 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-5-(2-methoxyethoxy)pentanoic acid |
| SMILES | COCCOCCCC(Cc1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C15H21ClO4/c1-19-9-10-20-8-4-6-13(15(17)18)11-12-5-2-3-7-14(12)16/h2-3,5,7,13H,4,6,8-11H2,1H3,(H,17,18) |
| InChIKey | WOUOSZOTLXXKAI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.78 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|