C20H20Cl2O5 — CID 10341550
ethyl (3R,4S)-6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate (PubChem CID 10341550) has the molecular formula C20H20Cl2O5 and a molecular weight of 411.28 g/mol. Its IUPAC name is ethyl (3R,4S)-6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate.
| Compound Name | ethyl (3R,4S)-6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate |
|---|---|
| PubChem CID | 10341550 |
| Molecular Formula | C20H20Cl2O5 |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | ethyl (3R,4S)-6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxane-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC(c2ccc(Cl)cc2)(c2ccc(Cl)cc2)OO[C@@]1(C)O |
| InChI | InChI=1S/C20H20Cl2O5/c1-3-25-18(23)17-12-20(27-26-19(17,2)24,13-4-8-15(21)9-5-13)14-6-10-16(22)11-7-14/h4-11,17,24H,3,12H2,1-2H3/t17-,19-/m1/s1 |
| InChIKey | SBRZXOBWVZOSCO-IEBWSBKVSA-N |
| XLogP | 4.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|