C19H18Cl2O4 — CID 14872229
1-[6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxan-4-yl]ethanone (PubChem CID 14872229) has the molecular formula C19H18Cl2O4 and a molecular weight of 381.26 g/mol. Its IUPAC name is 1-[6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxan-4-yl]ethanone.
| Compound Name | 1-[6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxan-4-yl]ethanone |
|---|---|
| PubChem CID | 14872229 |
| Molecular Formula | C19H18Cl2O4 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 1-[6,6-bis(4-chlorophenyl)-3-hydroxy-3-methyldioxan-4-yl]ethanone |
| SMILES | CC(=O)C1CC(c2ccc(Cl)cc2)(c2ccc(Cl)cc2)OOC1(C)O |
| InChI | InChI=1S/C19H18Cl2O4/c1-12(22)17-11-19(25-24-18(17,2)23,13-3-7-15(20)8-4-13)14-5-9-16(21)10-6-14/h3-10,17,23H,11H2,1-2H3 |
| InChIKey | BHPUWKHXCXXWAV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|