C21H20Cl2O4 — CID 14983161
3,3-bis(4-chlorophenyl)-8a-hydroxy-4a-methyl-4,6,7,8-tetrahydrobenzo[c][1,2]dioxin-5-one (PubChem CID 14983161) has the molecular formula C21H20Cl2O4 and a molecular weight of 407.29 g/mol. Its IUPAC name is 3,3-bis(4-chlorophenyl)-8a-hydroxy-4a-methyl-4,6,7,8-tetrahydrobenzo[c][1,2]dioxin-5-one.
| Compound Name | 3,3-bis(4-chlorophenyl)-8a-hydroxy-4a-methyl-4,6,7,8-tetrahydrobenzo[c][1,2]dioxin-5-one |
|---|---|
| PubChem CID | 14983161 |
| Molecular Formula | C21H20Cl2O4 |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 3,3-bis(4-chlorophenyl)-8a-hydroxy-4a-methyl-4,6,7,8-tetrahydrobenzo[c][1,2]dioxin-5-one |
| SMILES | CC12CC(c3ccc(Cl)cc3)(c3ccc(Cl)cc3)OOC1(O)CCCC2=O |
| InChI | InChI=1S/C21H20Cl2O4/c1-19-13-20(14-4-8-16(22)9-5-14,15-6-10-17(23)11-7-15)26-27-21(19,25)12-2-3-18(19)24/h4-11,25H,2-3,12-13H2,1H3 |
| InChIKey | MKRPMHAJEYYORM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|