C21H22O4 — CID 14983155
8a-hydroxy-4a-methyl-3,3-diphenyl-4,6,7,8-tetrahydrobenzo[c][1,2]dioxin-5-one (PubChem CID 14983155) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is 8a-hydroxy-4a-methyl-3,3-diphenyl-4,6,7,8-tetrahydrobenzo[c][1,2]dioxin-5-one.
| Compound Name | 8a-hydroxy-4a-methyl-3,3-diphenyl-4,6,7,8-tetrahydrobenzo[c][1,2]dioxin-5-one |
|---|---|
| PubChem CID | 14983155 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 8a-hydroxy-4a-methyl-3,3-diphenyl-4,6,7,8-tetrahydrobenzo[c][1,2]dioxin-5-one |
| SMILES | CC12CC(c3ccccc3)(c3ccccc3)OOC1(O)CCCC2=O |
| InChI | InChI=1S/C21H22O4/c1-19-15-20(16-9-4-2-5-10-16,17-11-6-3-7-12-17)24-25-21(19,23)14-8-13-18(19)22/h2-7,9-12,23H,8,13-15H2,1H3 |
| InChIKey | DTGJWJBVCPXZFH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|