C21H24O4 — CID 14872231
1-[3-hydroxy-3-methyl-6,6-bis(4-methylphenyl)dioxan-4-yl]ethanone (PubChem CID 14872231) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-[3-hydroxy-3-methyl-6,6-bis(4-methylphenyl)dioxan-4-yl]ethanone.
| Compound Name | 1-[3-hydroxy-3-methyl-6,6-bis(4-methylphenyl)dioxan-4-yl]ethanone |
|---|---|
| PubChem CID | 14872231 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 1-[3-hydroxy-3-methyl-6,6-bis(4-methylphenyl)dioxan-4-yl]ethanone |
| SMILES | CC(=O)C1CC(c2ccc(C)cc2)(c2ccc(C)cc2)OOC1(C)O |
| InChI | InChI=1S/C21H24O4/c1-14-5-9-17(10-6-14)21(18-11-7-15(2)8-12-18)13-19(16(3)22)20(4,23)24-25-21/h5-12,19,23H,13H2,1-4H3 |
| InChIKey | IKCZTTNZXGQHNG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|