C20H22O4 — CID 14983159
1-(3-hydroxy-3,4-dimethyl-6,6-diphenyldioxan-4-yl)ethanone (PubChem CID 14983159) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is 1-(3-hydroxy-3,4-dimethyl-6,6-diphenyldioxan-4-yl)ethanone.
| Compound Name | 1-(3-hydroxy-3,4-dimethyl-6,6-diphenyldioxan-4-yl)ethanone |
|---|---|
| PubChem CID | 14983159 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-(3-hydroxy-3,4-dimethyl-6,6-diphenyldioxan-4-yl)ethanone |
| SMILES | CC(=O)C1(C)CC(c2ccccc2)(c2ccccc2)OOC1(C)O |
| InChI | InChI=1S/C20H22O4/c1-15(21)18(2)14-20(24-23-19(18,3)22,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,22H,14H2,1-3H3 |
| InChIKey | KDSFVSBEONBGKR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|