C20H20O4 — CID 14983156
7a-hydroxy-4a-methyl-3,3-diphenyl-6,7-dihydro-4H-cyclopenta[c][1,2]dioxin-5-one (PubChem CID 14983156) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 7a-hydroxy-4a-methyl-3,3-diphenyl-6,7-dihydro-4H-cyclopenta[c][1,2]dioxin-5-one.
| Compound Name | 7a-hydroxy-4a-methyl-3,3-diphenyl-6,7-dihydro-4H-cyclopenta[c][1,2]dioxin-5-one |
|---|---|
| PubChem CID | 14983156 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 7a-hydroxy-4a-methyl-3,3-diphenyl-6,7-dihydro-4H-cyclopenta[c][1,2]dioxin-5-one |
| SMILES | CC12CC(c3ccccc3)(c3ccccc3)OOC1(O)CCC2=O |
| InChI | InChI=1S/C20H20O4/c1-18-14-19(15-8-4-2-5-9-15,16-10-6-3-7-11-16)23-24-20(18,22)13-12-17(18)21/h2-11,22H,12-14H2,1H3 |
| InChIKey | QSQJMEBAXTVKKG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|