C15H18O4 — CID 11521784
1-(7a-hydroxy-3-phenyl-4,5,6,7-tetrahydro-3H-cyclopenta[c][1,2]dioxin-4a-yl)ethanone (PubChem CID 11521784) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-(7a-hydroxy-3-phenyl-4,5,6,7-tetrahydro-3H-cyclopenta[c][1,2]dioxin-4a-yl)ethanone.
| Compound Name | 1-(7a-hydroxy-3-phenyl-4,5,6,7-tetrahydro-3H-cyclopenta[c][1,2]dioxin-4a-yl)ethanone |
|---|---|
| PubChem CID | 11521784 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-(7a-hydroxy-3-phenyl-4,5,6,7-tetrahydro-3H-cyclopenta[c][1,2]dioxin-4a-yl)ethanone |
| SMILES | CC(=O)C12CCCC1(O)OOC(c1ccccc1)C2 |
| InChI | InChI=1S/C15H18O4/c1-11(16)14-8-5-9-15(14,17)19-18-13(10-14)12-6-3-2-4-7-12/h2-4,6-7,13,17H,5,8-10H2,1H3 |
| InChIKey | ACQCPKOULRSXIR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|