C19H20O4 — CID 14872228
1-(3-hydroxy-3-methyl-6,6-diphenyldioxan-4-yl)ethanone (PubChem CID 14872228) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-(3-hydroxy-3-methyl-6,6-diphenyldioxan-4-yl)ethanone.
| Compound Name | 1-(3-hydroxy-3-methyl-6,6-diphenyldioxan-4-yl)ethanone |
|---|---|
| PubChem CID | 14872228 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-(3-hydroxy-3-methyl-6,6-diphenyldioxan-4-yl)ethanone |
| SMILES | CC(=O)C1CC(c2ccccc2)(c2ccccc2)OOC1(C)O |
| InChI | InChI=1S/C19H20O4/c1-14(20)17-13-19(23-22-18(17,2)21,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17,21H,13H2,1-2H3 |
| InChIKey | BTXRKYLOSKXNLU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|