C19H19ClO4 — CID 10315643
1-[6-(4-chlorophenyl)-3-hydroxy-3-methyl-6-phenyldioxan-4-yl]ethanone (PubChem CID 10315643) has the molecular formula C19H19ClO4 and a molecular weight of 346.81 g/mol. Its IUPAC name is 1-[6-(4-chlorophenyl)-3-hydroxy-3-methyl-6-phenyldioxan-4-yl]ethanone.
| Compound Name | 1-[6-(4-chlorophenyl)-3-hydroxy-3-methyl-6-phenyldioxan-4-yl]ethanone |
|---|---|
| PubChem CID | 10315643 |
| Molecular Formula | C19H19ClO4 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-[6-(4-chlorophenyl)-3-hydroxy-3-methyl-6-phenyldioxan-4-yl]ethanone |
| SMILES | CC(=O)C1CC(c2ccccc2)(c2ccc(Cl)cc2)OOC1(C)O |
| InChI | InChI=1S/C19H19ClO4/c1-13(21)17-12-19(24-23-18(17,2)22,14-6-4-3-5-7-14)15-8-10-16(20)11-9-15/h3-11,17,22H,12H2,1-2H3 |
| InChIKey | OECFPFHIJUDTKT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|