C22H20Cl2F6O4 — CID 139121259
(4S)-4-(4-chlorophenyl)-5,5,5-trifluoro-4-hydroxypentan-2-one (PubChem CID 139121259) has the molecular formula C22H20Cl2F6O4 and a molecular weight of 533.29 g/mol. Its IUPAC name is (4S)-4-(4-chlorophenyl)-5,5,5-trifluoro-4-hydroxypentan-2-one.
| Compound Name | (4S)-4-(4-chlorophenyl)-5,5,5-trifluoro-4-hydroxypentan-2-one |
|---|---|
| PubChem CID | 139121259 |
| Molecular Formula | C22H20Cl2F6O4 |
| Molecular Weight | 533.29 g/mol |
| Exact Mass | 532.06 |
| IUPAC Name | (4S)-4-(4-chlorophenyl)-5,5,5-trifluoro-4-hydroxypentan-2-one |
| SMILES | CC(=O)C[C@](O)(c1ccc(Cl)cc1)C(F)(F)F.CC(=O)C[C@](O)(c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/2C11H10ClF3O2/c2*1-7(16)6-10(17,11(13,14)15)8-2-4-9(12)5-3-8/h2*2-5,17H,6H2,1H3/t2*10-/m00/s1 |
| InChIKey | RIOVEZDEMNDCNU-LARVRRBISA-N |
| XLogP | 6.14 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.29 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |