C18H14ClF5O2 — CID 71506172
5-(4-chlorophenyl)-4,4,6,6,6-pentafluoro-5-hydroxy-1-phenylhexan-3-one (PubChem CID 71506172) has the molecular formula C18H14ClF5O2 and a molecular weight of 392.75 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4,4,6,6,6-pentafluoro-5-hydroxy-1-phenylhexan-3-one.
| Compound Name | 5-(4-chlorophenyl)-4,4,6,6,6-pentafluoro-5-hydroxy-1-phenylhexan-3-one |
|---|---|
| PubChem CID | 71506172 |
| Molecular Formula | C18H14ClF5O2 |
| Molecular Weight | 392.75 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 5-(4-chlorophenyl)-4,4,6,6,6-pentafluoro-5-hydroxy-1-phenylhexan-3-one |
| SMILES | O=C(CCc1ccccc1)C(F)(F)C(O)(c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C18H14ClF5O2/c19-14-9-7-13(8-10-14)16(26,18(22,23)24)17(20,21)15(25)11-6-12-4-2-1-3-5-12/h1-5,7-10,26H,6,11H2 |
| InChIKey | UIZBUHICMKTSGC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.75 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |