About (E)-2-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol
(E)-2-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol (PubChem CID 89157740) has the molecular formula C16H12ClF3O
and a molecular weight of 312.72 g/mol. Its IUPAC name is (E)-2-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol.
Molecular Properties
| Compound Name | (E)-2-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol |
| PubChem CID | 89157740 |
| Molecular Formula | C16H12ClF3O |
| Molecular Weight | 312.72 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | (E)-2-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol |
| SMILES | OC(/C=C/c1ccccc1)(c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H12ClF3O/c17-14-8-6-13(7-9-14)15(21,16(18,19)20)11-10-12-4-2-1-3-5-12/h1-11,21H/b11-10+ |
| InChIKey | RJXBUPQHUBQDNK-ZHACJKMWSA-N |
| XLogP | 4.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.72 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-2-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol?
The IUPAC name of (E)-2-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol (CID 89157740) is (E)-2-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol.
What is the SMILES notation for (E)-2-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol?
The canonical SMILES for (E)-2-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol is OC(/C=C/c1ccccc1)(c1ccc(Cl)cc1)C(F)(F)F.
What is the InChIKey of (E)-2-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol?
The InChIKey is RJXBUPQHUBQDNK-ZHACJKMWSA-N. The full InChI is InChI=1S/C16H12ClF3O/c17-14-8-6-13(7-9-14)15(21,16(18,19)20)11-10-12-4-2-1-3-5-12/h1-11,21H/b11-10+.
What are the key properties of (E)-2-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol?
(E)-2-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol has a molecular weight of 312.72 g/mol, XLogP of 4.80, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(4-chlorophenyl)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol is sourced from PubChem (CID 89157740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).