C22H24O4 — CID 134928087
1-hydroxy-1-methyl-4,4-diphenyl-2,3-dioxaspiro[5.5]undecan-11-one (PubChem CID 134928087) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-hydroxy-1-methyl-4,4-diphenyl-2,3-dioxaspiro[5.5]undecan-11-one.
| Compound Name | 1-hydroxy-1-methyl-4,4-diphenyl-2,3-dioxaspiro[5.5]undecan-11-one |
|---|---|
| PubChem CID | 134928087 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1-hydroxy-1-methyl-4,4-diphenyl-2,3-dioxaspiro[5.5]undecan-11-one |
| SMILES | CC1(O)OOC(c2ccccc2)(c2ccccc2)CC12CCCCC2=O |
| InChI | InChI=1S/C22H24O4/c1-20(24)21(15-9-8-14-19(21)23)16-22(26-25-20,17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-7,10-13,24H,8-9,14-16H2,1H3 |
| InChIKey | JTGWJPWKQVYIAS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|