C20H18Cl2O4 — CID 10318395
3,3-bis(4-chlorophenyl)-8a-hydroxy-4a,6,7,8-tetrahydro-4H-benzo[c][1,2]dioxin-5-one (PubChem CID 10318395) has the molecular formula C20H18Cl2O4 and a molecular weight of 393.27 g/mol. Its IUPAC name is 3,3-bis(4-chlorophenyl)-8a-hydroxy-4a,6,7,8-tetrahydro-4H-benzo[c][1,2]dioxin-5-one.
| Compound Name | 3,3-bis(4-chlorophenyl)-8a-hydroxy-4a,6,7,8-tetrahydro-4H-benzo[c][1,2]dioxin-5-one |
|---|---|
| PubChem CID | 10318395 |
| Molecular Formula | C20H18Cl2O4 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 3,3-bis(4-chlorophenyl)-8a-hydroxy-4a,6,7,8-tetrahydro-4H-benzo[c][1,2]dioxin-5-one |
| SMILES | O=C1CCCC2(O)OOC(c3ccc(Cl)cc3)(c3ccc(Cl)cc3)CC12 |
| InChI | InChI=1S/C20H18Cl2O4/c21-15-7-3-13(4-8-15)19(14-5-9-16(22)10-6-14)12-17-18(23)2-1-11-20(17,24)26-25-19/h3-10,17,24H,1-2,11-12H2 |
| InChIKey | NQJICDQTVWARCX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|