C20H19ClO4 — CID 10383799
3-(4-chlorophenyl)-8a-hydroxy-3-phenyl-4a,6,7,8-tetrahydro-4H-benzo[c][1,2]dioxin-5-one (PubChem CID 10383799) has the molecular formula C20H19ClO4 and a molecular weight of 358.82 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-8a-hydroxy-3-phenyl-4a,6,7,8-tetrahydro-4H-benzo[c][1,2]dioxin-5-one.
| Compound Name | 3-(4-chlorophenyl)-8a-hydroxy-3-phenyl-4a,6,7,8-tetrahydro-4H-benzo[c][1,2]dioxin-5-one |
|---|---|
| PubChem CID | 10383799 |
| Molecular Formula | C20H19ClO4 |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-(4-chlorophenyl)-8a-hydroxy-3-phenyl-4a,6,7,8-tetrahydro-4H-benzo[c][1,2]dioxin-5-one |
| SMILES | O=C1CCCC2(O)OOC(c3ccccc3)(c3ccc(Cl)cc3)CC12 |
| InChI | InChI=1S/C20H19ClO4/c21-16-10-8-15(9-11-16)19(14-5-2-1-3-6-14)13-17-18(22)7-4-12-20(17,23)25-24-19/h1-3,5-6,8-11,17,23H,4,7,12-13H2 |
| InChIKey | UWKYLTXNJHSRGP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|