C22H26O5 — CID 134928078
1-[3-hydroxy-3-[(2-methylpropan-2-yl)oxy]-6,6-diphenyldioxan-4-yl]ethanone (PubChem CID 134928078) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-[3-hydroxy-3-[(2-methylpropan-2-yl)oxy]-6,6-diphenyldioxan-4-yl]ethanone.
| Compound Name | 1-[3-hydroxy-3-[(2-methylpropan-2-yl)oxy]-6,6-diphenyldioxan-4-yl]ethanone |
|---|---|
| PubChem CID | 134928078 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-[3-hydroxy-3-[(2-methylpropan-2-yl)oxy]-6,6-diphenyldioxan-4-yl]ethanone |
| SMILES | CC(=O)C1CC(c2ccccc2)(c2ccccc2)OOC1(O)OC(C)(C)C |
| InChI | InChI=1S/C22H26O5/c1-16(23)19-15-21(17-11-7-5-8-12-17,18-13-9-6-10-14-18)26-27-22(19,24)25-20(2,3)4/h5-14,19,24H,15H2,1-4H3 |
| InChIKey | BKNYLDMNFPSEFR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|