C12H16BrNO4S2 — CID 1034160
ethyl (2R)-1-(5-bromothiophen-2-yl)sulfonylpiperidine-2-carboxylate (PubChem CID 1034160) has the molecular formula C12H16BrNO4S2 and a molecular weight of 382.30 g/mol. Its IUPAC name is ethyl (2R)-1-(5-bromothiophen-2-yl)sulfonylpiperidine-2-carboxylate.
| Compound Name | ethyl (2R)-1-(5-bromothiophen-2-yl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 1034160 |
| Molecular Formula | C12H16BrNO4S2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | ethyl (2R)-1-(5-bromothiophen-2-yl)sulfonylpiperidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCCN1S(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C12H16BrNO4S2/c1-2-18-12(15)9-5-3-4-8-14(9)20(16,17)11-7-6-10(13)19-11/h6-7,9H,2-5,8H2,1H3/t9-/m1/s1 |
| InChIKey | GUDWLCMQQMODQI-SECBINFHSA-N |
| XLogP | 2.62 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |