C12H17Br2NO4S2 — CID 3860859
ethyl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]hexanoate (PubChem CID 3860859) has the molecular formula C12H17Br2NO4S2 and a molecular weight of 463.21 g/mol. Its IUPAC name is ethyl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]hexanoate.
| Compound Name | ethyl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 3860859 |
| Molecular Formula | C12H17Br2NO4S2 |
| Molecular Weight | 463.21 g/mol |
| Exact Mass | 460.90 |
| IUPAC Name | ethyl 2-[(4,5-dibromothiophen-2-yl)sulfonylamino]hexanoate |
| SMILES | CCCCC(NS(=O)(=O)c1cc(Br)c(Br)s1)C(=O)OCC |
| InChI | InChI=1S/C12H17Br2NO4S2/c1-3-5-6-9(12(16)19-4-2)15-21(17,18)10-7-8(13)11(14)20-10/h7,9,15H,3-6H2,1-2H3 |
| InChIKey | YWGYGNHOSPIVCX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.21 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |