C18H18Cl2N2O3S — CID 10341636
2-[1-(benzenesulfonyl)-5,7-dichloroindol-3-yl]oxy-N,N-dimethylethanamine (PubChem CID 10341636) has the molecular formula C18H18Cl2N2O3S and a molecular weight of 413.33 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)-5,7-dichloroindol-3-yl]oxy-N,N-dimethylethanamine.
| Compound Name | 2-[1-(benzenesulfonyl)-5,7-dichloroindol-3-yl]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 10341636 |
| Molecular Formula | C18H18Cl2N2O3S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 2-[1-(benzenesulfonyl)-5,7-dichloroindol-3-yl]oxy-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1cn(S(=O)(=O)c2ccccc2)c2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C18H18Cl2N2O3S/c1-21(2)8-9-25-17-12-22(18-15(17)10-13(19)11-16(18)20)26(23,24)14-6-4-3-5-7-14/h3-7,10-12H,8-9H2,1-2H3 |
| InChIKey | WRMXCEHZGISDBU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |