C11H11Br2N3O2 — CID 103416839
2-[1-(2,4-dibromo-5-methoxyphenyl)triazol-4-yl]ethanol (PubChem CID 103416839) has the molecular formula C11H11Br2N3O2 and a molecular weight of 377.04 g/mol. Its IUPAC name is 2-[1-(2,4-dibromo-5-methoxyphenyl)triazol-4-yl]ethanol.
| Compound Name | 2-[1-(2,4-dibromo-5-methoxyphenyl)triazol-4-yl]ethanol |
|---|---|
| PubChem CID | 103416839 |
| Molecular Formula | C11H11Br2N3O2 |
| Molecular Weight | 377.04 g/mol |
| Exact Mass | 374.92 |
| IUPAC Name | 2-[1-(2,4-dibromo-5-methoxyphenyl)triazol-4-yl]ethanol |
| SMILES | COc1cc(-n2cc(CCO)nn2)c(Br)cc1Br |
| InChI | InChI=1S/C11H11Br2N3O2/c1-18-11-5-10(8(12)4-9(11)13)16-6-7(2-3-17)14-15-16/h4-6,17H,2-3H2,1H3 |
| InChIKey | AQJWPRWNGFAUQQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.04 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |