C10H8BrCl2N3O — CID 107794056
2-[1-(4-bromo-2,3-dichlorophenyl)triazol-4-yl]ethanol (PubChem CID 107794056) has the molecular formula C10H8BrCl2N3O and a molecular weight of 337.00 g/mol. Its IUPAC name is 2-[1-(4-bromo-2,3-dichlorophenyl)triazol-4-yl]ethanol.
| Compound Name | 2-[1-(4-bromo-2,3-dichlorophenyl)triazol-4-yl]ethanol |
|---|---|
| PubChem CID | 107794056 |
| Molecular Formula | C10H8BrCl2N3O |
| Molecular Weight | 337.00 g/mol |
| Exact Mass | 334.92 |
| IUPAC Name | 2-[1-(4-bromo-2,3-dichlorophenyl)triazol-4-yl]ethanol |
| SMILES | OCCc1cn(-c2ccc(Br)c(Cl)c2Cl)nn1 |
| InChI | InChI=1S/C10H8BrCl2N3O/c11-7-1-2-8(10(13)9(7)12)16-5-6(3-4-17)14-15-16/h1-2,5,17H,3-4H2 |
| InChIKey | PHENONSTISKYAB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.00 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|