C10H15N3OS — CID 103420224
3-amino-5-(dimethylamino)-4-propan-2-yloxythiophene-2-carbonitrile (PubChem CID 103420224) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is 3-amino-5-(dimethylamino)-4-propan-2-yloxythiophene-2-carbonitrile.
| Compound Name | 3-amino-5-(dimethylamino)-4-propan-2-yloxythiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103420224 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 3-amino-5-(dimethylamino)-4-propan-2-yloxythiophene-2-carbonitrile |
| SMILES | CC(C)Oc1c(N(C)C)sc(C#N)c1N |
| InChI | InChI=1S/C10H15N3OS/c1-6(2)14-9-8(12)7(5-11)15-10(9)13(3)4/h6H,12H2,1-4H3 |
| InChIKey | PUZCBMHZUPDBFH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |