C10H17N3OS — CID 103420375
3-amino-5-[butyl(methyl)amino]thiophene-2-carboxamide (PubChem CID 103420375) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 3-amino-5-[butyl(methyl)amino]thiophene-2-carboxamide.
| Compound Name | 3-amino-5-[butyl(methyl)amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103420375 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-amino-5-[butyl(methyl)amino]thiophene-2-carboxamide |
| SMILES | CCCCN(C)c1cc(N)c(C(N)=O)s1 |
| InChI | InChI=1S/C10H17N3OS/c1-3-4-5-13(2)8-6-7(11)9(15-8)10(12)14/h6H,3-5,11H2,1-2H3,(H2,12,14) |
| InChIKey | XMZNWHMAUIZXPY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |