C12H17N3OS2 — CID 103422654
3-amino-5-[3-(methoxymethyl)pyrrolidin-1-yl]-4-methylsulfanylthiophene-2-carbonitrile (PubChem CID 103422654) has the molecular formula C12H17N3OS2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 3-amino-5-[3-(methoxymethyl)pyrrolidin-1-yl]-4-methylsulfanylthiophene-2-carbonitrile.
| Compound Name | 3-amino-5-[3-(methoxymethyl)pyrrolidin-1-yl]-4-methylsulfanylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103422654 |
| Molecular Formula | C12H17N3OS2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3-amino-5-[3-(methoxymethyl)pyrrolidin-1-yl]-4-methylsulfanylthiophene-2-carbonitrile |
| SMILES | COCC1CCN(c2sc(C#N)c(N)c2SC)C1 |
| InChI | InChI=1S/C12H17N3OS2/c1-16-7-8-3-4-15(6-8)12-11(17-2)10(14)9(5-13)18-12/h8H,3-4,6-7,14H2,1-2H3 |
| InChIKey | MYRLLJLUDHGGGA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |