About 2-(5-chlorothiophene-2-carbonyl)-3,6-dimethylbenzoic acid
2-(5-chlorothiophene-2-carbonyl)-3,6-dimethylbenzoic acid (PubChem CID 103430128) has the molecular formula C14H11ClO3S
and a molecular weight of 294.76 g/mol. Its IUPAC name is 2-(5-chlorothiophene-2-carbonyl)-3,6-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 2-(5-chlorothiophene-2-carbonyl)-3,6-dimethylbenzoic acid |
| PubChem CID | 103430128 |
| Molecular Formula | C14H11ClO3S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 2-(5-chlorothiophene-2-carbonyl)-3,6-dimethylbenzoic acid |
| SMILES | Cc1ccc(C)c(C(=O)c2ccc(Cl)s2)c1C(=O)O |
| InChI | InChI=1S/C14H11ClO3S/c1-7-3-4-8(2)12(14(17)18)11(7)13(16)9-5-6-10(15)19-9/h3-6H,1-2H3,(H,17,18) |
| InChIKey | CRGPMBPPSBVZMB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-chlorothiophene-2-carbonyl)-3,6-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chlorothiophene-2-carbonyl)-3,6-dimethylbenzoic acid?
The IUPAC name of 2-(5-chlorothiophene-2-carbonyl)-3,6-dimethylbenzoic acid (CID 103430128) is 2-(5-chlorothiophene-2-carbonyl)-3,6-dimethylbenzoic acid.
What is the SMILES notation for 2-(5-chlorothiophene-2-carbonyl)-3,6-dimethylbenzoic acid?
The canonical SMILES for 2-(5-chlorothiophene-2-carbonyl)-3,6-dimethylbenzoic acid is Cc1ccc(C)c(C(=O)c2ccc(Cl)s2)c1C(=O)O.
What is the InChIKey of 2-(5-chlorothiophene-2-carbonyl)-3,6-dimethylbenzoic acid?
The InChIKey is CRGPMBPPSBVZMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClO3S/c1-7-3-4-8(2)12(14(17)18)11(7)13(16)9-5-6-10(15)19-9/h3-6H,1-2H3,(H,17,18).
What are the key properties of 2-(5-chlorothiophene-2-carbonyl)-3,6-dimethylbenzoic acid?
2-(5-chlorothiophene-2-carbonyl)-3,6-dimethylbenzoic acid has a molecular weight of 294.76 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chlorothiophene-2-carbonyl)-3,6-dimethylbenzoic acid is sourced from PubChem (CID 103430128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).