C13H20N4O2S2 — CID 103431108
3-amino-4-ethylsulfonyl-5-[(1-methylpyrrolidin-3-yl)methylamino]thiophene-2-carbonitrile (PubChem CID 103431108) has the molecular formula C13H20N4O2S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 3-amino-4-ethylsulfonyl-5-[(1-methylpyrrolidin-3-yl)methylamino]thiophene-2-carbonitrile.
| Compound Name | 3-amino-4-ethylsulfonyl-5-[(1-methylpyrrolidin-3-yl)methylamino]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103431108 |
| Molecular Formula | C13H20N4O2S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 3-amino-4-ethylsulfonyl-5-[(1-methylpyrrolidin-3-yl)methylamino]thiophene-2-carbonitrile |
| SMILES | CCS(=O)(=O)c1c(NCC2CCN(C)C2)sc(C#N)c1N |
| InChI | InChI=1S/C13H20N4O2S2/c1-3-21(18,19)12-11(15)10(6-14)20-13(12)16-7-9-4-5-17(2)8-9/h9,16H,3-5,7-8,15H2,1-2H3 |
| InChIKey | ICUVNNWRLKBXEN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |