C19H28O2 — CID 103432732
8-(2-methoxy-3,4-dimethylphenyl)spiro[4.5]decan-8-ol (PubChem CID 103432732) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 8-(2-methoxy-3,4-dimethylphenyl)spiro[4.5]decan-8-ol.
| Compound Name | 8-(2-methoxy-3,4-dimethylphenyl)spiro[4.5]decan-8-ol |
|---|---|
| PubChem CID | 103432732 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 8-(2-methoxy-3,4-dimethylphenyl)spiro[4.5]decan-8-ol |
| SMILES | COc1c(C2(O)CCC3(CCCC3)CC2)ccc(C)c1C |
| InChI | InChI=1S/C19H28O2/c1-14-6-7-16(17(21-3)15(14)2)19(20)12-10-18(11-13-19)8-4-5-9-18/h6-7,20H,4-5,8-13H2,1-3H3 |
| InChIKey | WLAXWTBDDWQHJD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |