C12H16O3 — CID 84780188
4-(1-hydroxycyclopropyl)-3-methoxy-2,6-dimethylphenol (PubChem CID 84780188) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-(1-hydroxycyclopropyl)-3-methoxy-2,6-dimethylphenol.
| Compound Name | 4-(1-hydroxycyclopropyl)-3-methoxy-2,6-dimethylphenol |
|---|---|
| PubChem CID | 84780188 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 4-(1-hydroxycyclopropyl)-3-methoxy-2,6-dimethylphenol |
| SMILES | COc1c(C2(O)CC2)cc(C)c(O)c1C |
| InChI | InChI=1S/C12H16O3/c1-7-6-9(12(14)4-5-12)11(15-3)8(2)10(7)13/h6,13-14H,4-5H2,1-3H3 |
| InChIKey | CGXIKUASNDIZFR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |