C17H27NO2 — CID 103434856
6-amino-4-ethyl-1-(2-methoxy-3,4-dimethylphenyl)hexan-1-one (PubChem CID 103434856) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 6-amino-4-ethyl-1-(2-methoxy-3,4-dimethylphenyl)hexan-1-one.
| Compound Name | 6-amino-4-ethyl-1-(2-methoxy-3,4-dimethylphenyl)hexan-1-one |
|---|---|
| PubChem CID | 103434856 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 6-amino-4-ethyl-1-(2-methoxy-3,4-dimethylphenyl)hexan-1-one |
| SMILES | CCC(CCN)CCC(=O)c1ccc(C)c(C)c1OC |
| InChI | InChI=1S/C17H27NO2/c1-5-14(10-11-18)7-9-16(19)15-8-6-12(2)13(3)17(15)20-4/h6,8,14H,5,7,9-11,18H2,1-4H3 |
| InChIKey | XPVJBUUSUXEKIS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |