C15H22BrNO3 — CID 103524296
6-amino-1-(3-bromo-2,4-dimethoxyphenyl)-4-methylhexan-1-one (PubChem CID 103524296) has the molecular formula C15H22BrNO3 and a molecular weight of 344.25 g/mol. Its IUPAC name is 6-amino-1-(3-bromo-2,4-dimethoxyphenyl)-4-methylhexan-1-one.
| Compound Name | 6-amino-1-(3-bromo-2,4-dimethoxyphenyl)-4-methylhexan-1-one |
|---|---|
| PubChem CID | 103524296 |
| Molecular Formula | C15H22BrNO3 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 6-amino-1-(3-bromo-2,4-dimethoxyphenyl)-4-methylhexan-1-one |
| SMILES | COc1ccc(C(=O)CCC(C)CCN)c(OC)c1Br |
| InChI | InChI=1S/C15H22BrNO3/c1-10(8-9-17)4-6-12(18)11-5-7-13(19-2)14(16)15(11)20-3/h5,7,10H,4,6,8-9,17H2,1-3H3 |
| InChIKey | SJVNJDDWQTVTRV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |