C14H21NOS — CID 103435508
(2-methoxy-3,4-dimethylphenyl)-(thiolan-3-yl)methanamine (PubChem CID 103435508) has the molecular formula C14H21NOS and a molecular weight of 251.39 g/mol. Its IUPAC name is (2-methoxy-3,4-dimethylphenyl)-(thiolan-3-yl)methanamine.
| Compound Name | (2-methoxy-3,4-dimethylphenyl)-(thiolan-3-yl)methanamine |
|---|---|
| PubChem CID | 103435508 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (2-methoxy-3,4-dimethylphenyl)-(thiolan-3-yl)methanamine |
| SMILES | COc1c(C(N)C2CCSC2)ccc(C)c1C |
| InChI | InChI=1S/C14H21NOS/c1-9-4-5-12(14(16-3)10(9)2)13(15)11-6-7-17-8-11/h4-5,11,13H,6-8,15H2,1-3H3 |
| InChIKey | AMECGBUBTGAQSI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |