C13H19NS — CID 105140674
(2,3-dimethylphenyl)-(thiolan-3-yl)methanamine (PubChem CID 105140674) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is (2,3-dimethylphenyl)-(thiolan-3-yl)methanamine.
| Compound Name | (2,3-dimethylphenyl)-(thiolan-3-yl)methanamine |
|---|---|
| PubChem CID | 105140674 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (2,3-dimethylphenyl)-(thiolan-3-yl)methanamine |
| SMILES | Cc1cccc(C(N)C2CCSC2)c1C |
| InChI | InChI=1S/C13H19NS/c1-9-4-3-5-12(10(9)2)13(14)11-6-7-15-8-11/h3-5,11,13H,6-8,14H2,1-2H3 |
| InChIKey | PRZLYIOSNKSJOR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |