C9H9BrN4O2 — CID 103437245
2-N-(4-bromo-3-methoxyphenyl)-1,3,4-oxadiazole-2,5-diamine (PubChem CID 103437245) has the molecular formula C9H9BrN4O2 and a molecular weight of 285.10 g/mol. Its IUPAC name is 2-N-(4-bromo-3-methoxyphenyl)-1,3,4-oxadiazole-2,5-diamine.
| Compound Name | 2-N-(4-bromo-3-methoxyphenyl)-1,3,4-oxadiazole-2,5-diamine |
|---|---|
| PubChem CID | 103437245 |
| Molecular Formula | C9H9BrN4O2 |
| Molecular Weight | 285.10 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 2-N-(4-bromo-3-methoxyphenyl)-1,3,4-oxadiazole-2,5-diamine |
| SMILES | COc1cc(Nc2nnc(N)o2)ccc1Br |
| InChI | InChI=1S/C9H9BrN4O2/c1-15-7-4-5(2-3-6(7)10)12-9-14-13-8(11)16-9/h2-4H,1H3,(H2,11,13)(H,12,14) |
| InChIKey | GNIBZJJAYWJKKT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.10 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |