C10H12N4O2 — CID 103436739
2-N-(4-methoxy-3-methylphenyl)-1,3,4-oxadiazole-2,5-diamine (PubChem CID 103436739) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-N-(4-methoxy-3-methylphenyl)-1,3,4-oxadiazole-2,5-diamine.
| Compound Name | 2-N-(4-methoxy-3-methylphenyl)-1,3,4-oxadiazole-2,5-diamine |
|---|---|
| PubChem CID | 103436739 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-N-(4-methoxy-3-methylphenyl)-1,3,4-oxadiazole-2,5-diamine |
| SMILES | COc1ccc(Nc2nnc(N)o2)cc1C |
| InChI | InChI=1S/C10H12N4O2/c1-6-5-7(3-4-8(6)15-2)12-10-14-13-9(11)16-10/h3-5H,1-2H3,(H2,11,13)(H,12,14) |
| InChIKey | JEOCEHVUUKRXSG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |