C18H34N2Si — CID 103438203
2,2-dimethyl-N'-propyl-N'-[(4-trimethylsilylphenyl)methyl]propane-1,3-diamine (PubChem CID 103438203) has the molecular formula C18H34N2Si and a molecular weight of 306.57 g/mol. Its IUPAC name is 2,2-dimethyl-N'-propyl-N'-[(4-trimethylsilylphenyl)methyl]propane-1,3-diamine.
| Compound Name | 2,2-dimethyl-N'-propyl-N'-[(4-trimethylsilylphenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 103438203 |
| Molecular Formula | C18H34N2Si |
| Molecular Weight | 306.57 g/mol |
| Exact Mass | 306.25 |
| IUPAC Name | 2,2-dimethyl-N'-propyl-N'-[(4-trimethylsilylphenyl)methyl]propane-1,3-diamine |
| SMILES | CCCN(Cc1ccc([Si](C)(C)C)cc1)CC(C)(C)CN |
| InChI | InChI=1S/C18H34N2Si/c1-7-12-20(15-18(2,3)14-19)13-16-8-10-17(11-9-16)21(4,5)6/h8-11H,7,12-15,19H2,1-6H3 |
| InChIKey | BFPZGIFQCNUMSB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|