C16H22N2OSi — CID 103438572
1-cyclopropyl-3-[(4-trimethylsilylphenyl)methyl]imidazol-2-one (PubChem CID 103438572) has the molecular formula C16H22N2OSi and a molecular weight of 286.45 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(4-trimethylsilylphenyl)methyl]imidazol-2-one.
| Compound Name | 1-cyclopropyl-3-[(4-trimethylsilylphenyl)methyl]imidazol-2-one |
|---|---|
| PubChem CID | 103438572 |
| Molecular Formula | C16H22N2OSi |
| Molecular Weight | 286.45 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-cyclopropyl-3-[(4-trimethylsilylphenyl)methyl]imidazol-2-one |
| SMILES | C[Si](C)(C)c1ccc(Cn2ccn(C3CC3)c2=O)cc1 |
| InChI | InChI=1S/C16H22N2OSi/c1-20(2,3)15-8-4-13(5-9-15)12-17-10-11-18(16(17)19)14-6-7-14/h4-5,8-11,14H,6-7,12H2,1-3H3 |
| InChIKey | XSKAYSULHRXBCQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|