C21H28N2O5S2 — CID 10343862
N-(5-formyl-8-pyridin-3-yloctyl)-4-methylsulfonylbenzenesulfonamide (PubChem CID 10343862) has the molecular formula C21H28N2O5S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is N-(5-formyl-8-pyridin-3-yloctyl)-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-(5-formyl-8-pyridin-3-yloctyl)-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 10343862 |
| Molecular Formula | C21H28N2O5S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | N-(5-formyl-8-pyridin-3-yloctyl)-4-methylsulfonylbenzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)NCCCCC(C=O)CCCc2cccnc2)cc1 |
| InChI | InChI=1S/C21H28N2O5S2/c1-29(25,26)20-10-12-21(13-11-20)30(27,28)23-15-3-2-6-19(17-24)8-4-7-18-9-5-14-22-16-18/h5,9-14,16-17,19,23H,2-4,6-8,15H2,1H3 |
| InChIKey | LONMDAKWZPBKSS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|