C10H14N2 — CID 103439300
N-cyclopropyl-2,6-dimethylpyridin-3-amine (PubChem CID 103439300) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is N-cyclopropyl-2,6-dimethylpyridin-3-amine.
| Compound Name | N-cyclopropyl-2,6-dimethylpyridin-3-amine |
|---|---|
| PubChem CID | 103439300 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | N-cyclopropyl-2,6-dimethylpyridin-3-amine |
| SMILES | Cc1ccc(NC2CC2)c(C)n1 |
| InChI | InChI=1S/C10H14N2/c1-7-3-6-10(8(2)11-7)12-9-4-5-9/h3,6,9,12H,4-5H2,1-2H3 |
| InChIKey | FHITZLAJYTZGMC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |