About 4-(cyclopentylamino)-2,6-dimethylpyridine-3-carbothioamide
4-(cyclopentylamino)-2,6-dimethylpyridine-3-carbothioamide (PubChem CID 81059850) has the molecular formula C13H19N3S
and a molecular weight of 249.38 g/mol. Its IUPAC name is 4-(cyclopentylamino)-2,6-dimethylpyridine-3-carbothioamide.
Molecular Properties
| Compound Name | 4-(cyclopentylamino)-2,6-dimethylpyridine-3-carbothioamide |
| PubChem CID | 81059850 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 4-(cyclopentylamino)-2,6-dimethylpyridine-3-carbothioamide |
| SMILES | Cc1cc(NC2CCCC2)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C13H19N3S/c1-8-7-11(16-10-5-3-4-6-10)12(13(14)17)9(2)15-8/h7,10H,3-6H2,1-2H3,(H2,14,17)(H,15,16) |
| InChIKey | YMFPTWWUILQHJO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(cyclopentylamino)-2,6-dimethylpyridine-3-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclopentylamino)-2,6-dimethylpyridine-3-carbothioamide?
The IUPAC name of 4-(cyclopentylamino)-2,6-dimethylpyridine-3-carbothioamide (CID 81059850) is 4-(cyclopentylamino)-2,6-dimethylpyridine-3-carbothioamide.
What is the SMILES notation for 4-(cyclopentylamino)-2,6-dimethylpyridine-3-carbothioamide?
The canonical SMILES for 4-(cyclopentylamino)-2,6-dimethylpyridine-3-carbothioamide is Cc1cc(NC2CCCC2)c(C(N)=S)c(C)n1.
What is the InChIKey of 4-(cyclopentylamino)-2,6-dimethylpyridine-3-carbothioamide?
The InChIKey is YMFPTWWUILQHJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3S/c1-8-7-11(16-10-5-3-4-6-10)12(13(14)17)9(2)15-8/h7,10H,3-6H2,1-2H3,(H2,14,17)(H,15,16).
What are the key properties of 4-(cyclopentylamino)-2,6-dimethylpyridine-3-carbothioamide?
4-(cyclopentylamino)-2,6-dimethylpyridine-3-carbothioamide has a molecular weight of 249.38 g/mol, XLogP of 2.69, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclopentylamino)-2,6-dimethylpyridine-3-carbothioamide is sourced from PubChem (CID 81059850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).