C14H16N4S2 — CID 81053925
4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-2,6-dimethylpyridine-3-carbothioamide (PubChem CID 81053925) has the molecular formula C14H16N4S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-2,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-2,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 81053925 |
| Molecular Formula | C14H16N4S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-2,6-dimethylpyridine-3-carbothioamide |
| SMILES | Cc1cc(Nc2nc(C3CC3)cs2)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C14H16N4S2/c1-7-5-10(12(13(15)19)8(2)16-7)17-14-18-11(6-20-14)9-3-4-9/h5-6,9H,3-4H2,1-2H3,(H2,15,19)(H,16,17,18) |
| InChIKey | RGANKKMAAZFKQR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|