About 4-(cycloheptylamino)-2,6-dimethylpyridine-3-carbothioamide
4-(cycloheptylamino)-2,6-dimethylpyridine-3-carbothioamide (PubChem CID 81054190) has the molecular formula C15H23N3S
and a molecular weight of 277.44 g/mol. Its IUPAC name is 4-(cycloheptylamino)-2,6-dimethylpyridine-3-carbothioamide.
Molecular Properties
| Compound Name | 4-(cycloheptylamino)-2,6-dimethylpyridine-3-carbothioamide |
| PubChem CID | 81054190 |
| Molecular Formula | C15H23N3S |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 4-(cycloheptylamino)-2,6-dimethylpyridine-3-carbothioamide |
| SMILES | Cc1cc(NC2CCCCCC2)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C15H23N3S/c1-10-9-13(14(15(16)19)11(2)17-10)18-12-7-5-3-4-6-8-12/h9,12H,3-8H2,1-2H3,(H2,16,19)(H,17,18) |
| InChIKey | HOUKSTLXXNKJIR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(cycloheptylamino)-2,6-dimethylpyridine-3-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cycloheptylamino)-2,6-dimethylpyridine-3-carbothioamide?
The IUPAC name of 4-(cycloheptylamino)-2,6-dimethylpyridine-3-carbothioamide (CID 81054190) is 4-(cycloheptylamino)-2,6-dimethylpyridine-3-carbothioamide.
What is the SMILES notation for 4-(cycloheptylamino)-2,6-dimethylpyridine-3-carbothioamide?
The canonical SMILES for 4-(cycloheptylamino)-2,6-dimethylpyridine-3-carbothioamide is Cc1cc(NC2CCCCCC2)c(C(N)=S)c(C)n1.
What is the InChIKey of 4-(cycloheptylamino)-2,6-dimethylpyridine-3-carbothioamide?
The InChIKey is HOUKSTLXXNKJIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3S/c1-10-9-13(14(15(16)19)11(2)17-10)18-12-7-5-3-4-6-8-12/h9,12H,3-8H2,1-2H3,(H2,16,19)(H,17,18).
What are the key properties of 4-(cycloheptylamino)-2,6-dimethylpyridine-3-carbothioamide?
4-(cycloheptylamino)-2,6-dimethylpyridine-3-carbothioamide has a molecular weight of 277.44 g/mol, XLogP of 3.47, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cycloheptylamino)-2,6-dimethylpyridine-3-carbothioamide is sourced from PubChem (CID 81054190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).