C14H20N2OS — CID 81053956
4-(cyclopentylmethoxy)-2,6-dimethylpyridine-3-carbothioamide (PubChem CID 81053956) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 4-(cyclopentylmethoxy)-2,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 4-(cyclopentylmethoxy)-2,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 81053956 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 4-(cyclopentylmethoxy)-2,6-dimethylpyridine-3-carbothioamide |
| SMILES | Cc1cc(OCC2CCCC2)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C14H20N2OS/c1-9-7-12(13(14(15)18)10(2)16-9)17-8-11-5-3-4-6-11/h7,11H,3-6,8H2,1-2H3,(H2,15,18) |
| InChIKey | JQCAORSCMMLXER-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|