C16H19N3OS — CID 81037735
2,6-dimethyl-4-(3-pyridin-4-ylpropoxy)pyridine-3-carbothioamide (PubChem CID 81037735) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 2,6-dimethyl-4-(3-pyridin-4-ylpropoxy)pyridine-3-carbothioamide.
| Compound Name | 2,6-dimethyl-4-(3-pyridin-4-ylpropoxy)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 81037735 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2,6-dimethyl-4-(3-pyridin-4-ylpropoxy)pyridine-3-carbothioamide |
| SMILES | Cc1cc(OCCCc2ccncc2)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C16H19N3OS/c1-11-10-14(15(16(17)21)12(2)19-11)20-9-3-4-13-5-7-18-8-6-13/h5-8,10H,3-4,9H2,1-2H3,(H2,17,21) |
| InChIKey | MLQZNAWANNQMML-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|